CAS 102349-35-9
:(2R,3R)-3-(4-hydroxy-3,5-dimethoxyphenyl)-2-(hydroxymethyl)-5-methoxy-2,3-dihydro-7H-[1,4]dioxino[2,3-c]xanthen-7-one
Description:
The chemical substance known as (2R,3R)-3-(4-hydroxy-3,5-dimethoxyphenyl)-2-(hydroxymethyl)-5-methoxy-2,3-dihydro-7H-[1,4]dioxino[2,3-c]xanthen-7-one, with the CAS number 102349-35-9, is a complex organic compound characterized by its multi-ring structure and various functional groups. It features a dioxino structure fused with a xanthenone moiety, which contributes to its potential biological activity. The presence of multiple methoxy and hydroxyl groups suggests that it may exhibit significant solubility in organic solvents and could participate in hydrogen bonding, influencing its reactivity and interaction with biological targets. This compound may be of interest in medicinal chemistry due to its structural features, which could be associated with antioxidant or anti-inflammatory properties. Additionally, the stereochemistry indicated by the (2R,3R) configuration suggests specific spatial arrangements that may affect its pharmacological profile. Overall, this compound represents a class of organic molecules that could have applications in drug development or as research tools in biochemistry.
Formula:C25H22O9
InChI:InChI=1/C25H22O9/c1-29-16-8-12(9-17(30-2)21(16)28)22-19(11-26)33-25-23-14(10-18(31-3)24(25)34-22)20(27)13-6-4-5-7-15(13)32-23/h4-10,19,22,26,28H,11H2,1-3H3/t19-,22-/m1/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
7H-1,4-Dioxino[2,3-c]xanthen-7-one, 2,3-dihydro-3-(4-hydroxy-3,5-dimethoxyphenyl)-2-(hydroxymethyl)-5-methoxy-, (2R,3R)-rel-
CAS:Formula:C25H22O9Purity:93.0%Molecular weight:466.4368Cadensin D
CAS:Cadensin D is a natural product for research related to life sciences. The catalog number is TN3562 and the CAS number is 102349-35-9.Formula:C25H22O9Purity:98%Color and Shape:SolidMolecular weight:466.44Cadensin D
CAS:Cadensin D is a small-molecule inhibitor that targets specific signaling proteins. It is synthesized through advanced organic chemistry techniques, enabling precise structural modifications for enhanced specificity and potency. The mode of action of Cadensin D involves binding to target proteins, altering their configuration, and subsequently modulating their activity. This modulation disrupts abnormal signaling pathways that are often implicated in various pathological conditions.
Formula:C25H22O9Purity:Min. 95%Molecular weight:466.4 g/mol


