CAS 10235-65-1

4,6-dichloro-2-(pyridin-2-yl)pyrimidine

Description:

4,6-Dichloro-2-(pyridin-2-yl)pyrimidine is a heterocyclic organic compound characterized by its pyrimidine core, which is substituted at the 4 and 6 positions with chlorine atoms and at the 2 position with a pyridine ring. This compound typically exhibits a crystalline solid form and is soluble in organic solvents, reflecting its polar nature due to the presence of chlorine and nitrogen atoms. It is often utilized in medicinal chemistry and agricultural applications, particularly as a building block in the synthesis of various pharmaceuticals and agrochemicals. The presence of the pyridine moiety can enhance its biological activity, making it a subject of interest in drug discovery. Additionally, the chlorinated positions can influence the compound's reactivity and stability, affecting its interactions in biological systems. Safety data indicates that, like many chlorinated compounds, it should be handled with care due to potential toxicity and environmental concerns.

Formula: C₉H₅Cl₂N₃

InChI: InChI=1/C9H5Cl2N3/c10-7-5-8(11)14-9(13-7)6-3-1-2-4-12-6/h1-5H

SMILES: c1ccnc(c1)c1nc(cc(Cl)n1)Cl

Synonyms:

• pyrimidine, 4,6-dichloro-2-(2-pyridinyl)-4,6-Dichloro-2-(2-Pyridinyl)Pyrimidine

Pyrimidine, 4,6-dichloro-2-(2-pyridinyl)-

CAS: 10235-65-1

Formula: C₉H₅Cl₂N₃

Purity: 96%

Color and Shape: Solid

Molecular weight: 226.0621

Ref: IN-DA00078L

4,6-Dichloro-2-(pyridin-2-yl)pyrimidine

CAS: 10235-65-1

4,6-Dichloro-2-(pyridin-2-yl)pyrimidine

Purity: 97%

Molecular weight: 226.06g/mol

Ref: 54-OR76309

4,6-Dichloro-2-(2-pyridinyl)pyrimidine

CAS: 10235-65-1

Formula: C₉H₅Cl₂N₃

Purity: 98%

Color and Shape: Solid, Off-white powder

Molecular weight: 226.06

Ref: 10-F214838