CAS 1023533-11-0

N-Cyclopentyl-1-phenylcyclopentanecarboxamide

Description:

N-Cyclopentyl-1-phenylcyclopentanecarboxamide is a chemical compound characterized by its unique structure, which includes a cyclopentyl group and a phenyl group attached to a cyclopentanecarboxamide backbone. This compound typically exhibits properties associated with amides, such as moderate solubility in organic solvents and potential stability under various conditions. The presence of the cyclopentyl and phenyl groups may contribute to its lipophilicity, influencing its interactions in biological systems. Additionally, the compound may exhibit specific pharmacological activities, making it of interest in medicinal chemistry. Its molecular structure suggests potential for conformational flexibility, which can affect its reactivity and binding interactions. As with many organic compounds, the characteristics such as melting point, boiling point, and specific reactivity would depend on the purity and specific conditions under which the compound is studied. Overall, N-Cyclopentyl-1-phenylcyclopentanecarboxamide represents a complex organic molecule with potential applications in various fields, including pharmaceuticals and materials science.

Formula: C₁₇H₂₃NO

InChI: InChI=1S/C17H23NO/c19-16(18-15-10-4-5-11-15)17(12-6-7-13-17)14-8-2-1-3-9-14/h1-3,8-9,15H,4-7,10-13H2,(H,18,19)

InChI key: InChIKey=LVZVHAISFOZZBK-UHFFFAOYSA-N

SMILES: C(NC1CCCC1)(=O)C2(CCCC2)C3=CC=CC=C3

Synonyms:

• Cyclopentanecarboxamide, N-cyclopentyl-1-phenyl-
• N-Cyclopentyl-1-phenylcyclopentanecarboxamide

N-cyclopentyl(phenylcyclopentyl)formamide

CAS: 1023533-11-0

Please enquire for more information about N-cyclopentyl(phenylcyclopentyl)formamide including the price, delivery time and more detailed product information at the technical inquiry form on this page

Formula: C₁₇H₂₃NO

Purity: Min. 95%

Molecular weight: 257.37 g/mol

Ref: 3D-YQB53311