CymitQuimica logo

CAS 1023595-60-9

:

1-(2,9-Diazaspiro[5.5]undec-9-yl)-2,2,2-trifluoroethanone

Description:
1-(2,9-Diazaspiro[5.5]undec-9-yl)-2,2,2-trifluoroethanone is a chemical compound characterized by its unique spirocyclic structure, which incorporates a diazabicyclic framework. This compound features a trifluoroethanone functional group, contributing to its reactivity and potential applications in organic synthesis and medicinal chemistry. The presence of the trifluoromethyl group enhances lipophilicity and can influence biological activity, making it of interest in drug design. The spiro structure introduces rigidity, which can affect the compound's conformational properties and interactions with biological targets. Additionally, the nitrogen atoms in the diazaspiro structure may participate in hydrogen bonding, further influencing its chemical behavior. This compound is typically studied for its potential pharmacological properties and may exhibit interesting characteristics such as solubility in organic solvents and stability under various conditions. As with many nitrogen-containing heterocycles, it may also show diverse reactivity patterns, making it a valuable candidate for further research in synthetic and medicinal chemistry.
Formula:C11H17F3N2O
InChI:InChI=1S/C11H17F3N2O/c12-11(13,14)9(17)16-6-3-10(4-7-16)2-1-5-15-8-10/h15H,1-8H2
InChI key:InChIKey=VRRQRXUGQPUBNQ-UHFFFAOYSA-N
SMILES:C(C(F)(F)F)(=O)N1CCC2(CC1)CCCNC2
Synonyms:
  • 1-(2,9-Diazaspiro[5.5]undec-9-yl)-2,2,2-trifluoroethanone
  • Ethanone, 1-(2,9-diazaspiro[5.5]undec-9-yl)-2,2,2-trifluoro-
  • 1-[2,9-Diazaspiro[5.5]undecan-9-yl]-2,2,2-trifluoroethan-1-one
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.