CAS 10236-44-9
:N(alpha)-acetylglycyllysyl methyl ester
Description:
N(alpha)-acetylglycyllysyl methyl ester, with the CAS number 10236-44-9, is a synthetic peptide derivative that features an acetyl group attached to the amino terminus of a glycine-lysine dipeptide. This compound is characterized by its structural components, which include an acetyl group, a glycine residue, and a lysine residue, with a methyl ester functional group at the carboxyl terminus. The presence of the acetyl group enhances the lipophilicity and stability of the peptide, while the methyl ester can influence its solubility and reactivity. This compound is often utilized in biochemical research and peptide synthesis, serving as a model for studying peptide interactions and modifications. Its properties, such as solubility in organic solvents and potential biological activity, make it of interest in various fields, including medicinal chemistry and biochemistry. As with many peptide derivatives, its stability and reactivity can be influenced by environmental factors such as pH and temperature.
Formula:C11H21N3O4
InChI:InChI=1/C11H21N3O4.C2H4O2/c1-8(15)13-7-10(16)14-9(11(17)18-2)5-3-4-6-12;1-2(3)4/h9H,3-7,12H2,1-2H3,(H,13,15)(H,14,16);1H3,(H,3,4)/t9-;/m0./s1
Synonyms:- N(alpha)-acetylglycyllysyl methyl ester
- AGLME
- L-Lysine, N3-(N-acetylglycyl)-, methyl ester
- methyl N-acetylglycyl-L-lysinate
- N-alpha-Acetyl-gly-lys-methyl ester
- methyl N-acetylglycyl-L-lysinate acetate
- N-alpha-Acetylglycine lysine methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
AGLME
CAS:AGLME is used in a direct enzymatic assay for activated Hageman factor measuring the ability of Hageman factor to hydrolyze the cpd.Formula:C11H21N3O4Color and Shape:SolidMolecular weight:259.3
