CAS 10236-60-9
:2,3-Dichlorophenylacetic acid
Description:
2,3-Dichlorophenylacetic acid is an organic compound characterized by its aromatic structure and the presence of two chlorine atoms on the phenyl ring. It features a carboxylic acid functional group, which contributes to its acidic properties. The compound is typically a white to off-white crystalline solid, and it is soluble in organic solvents while exhibiting limited solubility in water. Its molecular formula is C8H6Cl2O2, and it has a relatively low molecular weight. The presence of chlorine substituents influences its reactivity and biological activity, making it of interest in various chemical and pharmaceutical applications. 2,3-Dichlorophenylacetic acid can be synthesized through chlorination reactions and is often studied for its potential use in agrochemicals and as a building block in organic synthesis. Safety considerations include handling it with care due to its potential irritant properties and environmental impact. Overall, this compound exemplifies the diverse applications and significance of chlorinated aromatic acids in chemistry.
Formula:C8H5Cl2O2
InChI:InChI=1/C8H6Cl2O2/c9-6-3-1-2-5(8(6)10)4-7(11)12/h1-3H,4H2,(H,11,12)/p-1
SMILES:c1cc(CC(=O)[O-])c(c(c1)Cl)Cl
Synonyms:- Benzeneacetic acid, 2,3-dichloro-
- (2,3-Dichlorophenyl)Acetate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
2,3-Dichlorophenylacetic Acid
CAS:Formula:C8H6Cl2O2Purity:>98.0%(GC)(T)Color and Shape:White to Almost white powder to crystalMolecular weight:205.032,3-Dichlorophenylacetic acid, 98%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci
Formula:C8H5Cl2O2Purity:98%Color and Shape:White, PowderMolecular weight:204.03Benzeneacetic acid, 2,3-dichloro-
CAS:Formula:C8H6Cl2O2Purity:97%Color and Shape:SolidMolecular weight:205.03802,3-Dichlorophenylacetic acid
CAS:2,3-Dichlorophenylacetic acidPurity:≥98%Molecular weight:205.04g/mol2,3-Dichlorophenylacetic acid
CAS:Formula:C8H6Cl2O2Purity:≥98%Color and Shape:SolidMolecular weight:205.03





