CymitQuimica logo

CAS 1023649-51-5

:

4-Hydrazinyl-2-methylbenzonitrile

Description:
4-Hydrazinyl-2-methylbenzonitrile is an organic compound characterized by the presence of a hydrazine functional group and a nitrile group attached to a methyl-substituted aromatic ring. Its molecular structure features a benzene ring with a methyl group at the ortho position relative to the hydrazinyl group, which contributes to its reactivity and potential applications in various chemical reactions. The hydrazine moiety is known for its ability to act as a reducing agent and can participate in condensation reactions, making this compound of interest in synthetic organic chemistry. The nitrile group, on the other hand, is a versatile functional group that can undergo hydrolysis, reduction, or nucleophilic addition, further enhancing the compound's reactivity. 4-Hydrazinyl-2-methylbenzonitrile may exhibit biological activity, which could be explored for pharmaceutical applications. As with many hydrazine derivatives, safety precautions should be taken due to potential toxicity and reactivity. Overall, this compound represents a valuable building block in the synthesis of more complex organic molecules.
Formula:C8H9N3
InChI:InChI=1S/C8H9N3/c1-6-4-8(11-10)3-2-7(6)5-9/h2-4,11H,10H2,1H3
InChI key:InChIKey=ZAWYJBPSHRWJJB-UHFFFAOYSA-N
SMILES:N(N)C1=CC(C)=C(C#N)C=C1
Synonyms:
  • Benzonitrile, 4-hydrazinyl-2-methyl-
  • 4-Hydrazinyl-2-methylbenzonitrile
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.