CAS 1023649-53-7

Benzonitrile, 4-hydrazinyl-2-(trifluoromethyl)-, hydrochloride (1:1)

Description:

Benzonitrile, 4-hydrazinyl-2-(trifluoromethyl)-, hydrochloride (1:1) is a chemical compound characterized by its hydrazine and trifluoromethyl functional groups, which contribute to its unique reactivity and properties. The presence of the benzonitrile moiety indicates that it has a nitrile functional group attached to a benzene ring, which can influence its polarity and solubility in organic solvents. The hydrochloride form suggests that the compound is a salt, enhancing its stability and solubility in aqueous solutions. This compound may exhibit biological activity due to the hydrazine group, which is known for its potential in medicinal chemistry. Additionally, the trifluoromethyl group is known to enhance lipophilicity and metabolic stability, making the compound of interest in pharmaceutical applications. Overall, the combination of these functional groups suggests that this compound could be utilized in various chemical syntheses or as a potential lead in drug development, although specific applications would depend on further research into its biological properties and mechanisms of action.

Formula: C₈H₆F₃N₃·ClH

InChI: InChI=1S/C8H6F3N3.ClH/c9-8(10,11)7-3-6(14-13)2-1-5(7)4-12;/h1-3,14H,13H2;1H

InChI key: InChIKey=KXXSNUJUQCGZSS-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C1=C(C#N)C=CC(NN)=C1.Cl

Synonyms:

• Benzonitrile, 4-hydrazinyl-2-(trifluoromethyl)-, hydrochloride (1:1)
• 4-Hydrazinyl-2-(trifluoromethyl)benzonitrile hydrochloride