CAS 1023655-15-3
:1,1-Dimethylethyl N-[1-(3-amino-2-pyridinyl)-4-piperidinyl]carbamate
Description:
1,1-Dimethylethyl N-[1-(3-amino-2-pyridinyl)-4-piperidinyl]carbamate, identified by its CAS number 1023655-15-3, is a chemical compound characterized by its complex structure, which includes a carbamate functional group and a piperidine ring. This compound typically exhibits properties associated with both amines and carbamates, such as potential solubility in polar solvents and the ability to form hydrogen bonds due to the presence of amino and carbamate groups. Its molecular structure suggests it may have biological activity, possibly acting as a pharmacological agent, given the presence of the pyridine and piperidine moieties, which are often found in medicinal chemistry. The compound's stability, reactivity, and specific interactions would depend on its environment, including pH and temperature. Additionally, safety and handling considerations would be essential, as with many organic compounds, to mitigate any potential hazards associated with exposure or reactivity. Further studies would be necessary to fully elucidate its properties and potential applications in various fields, including pharmaceuticals.
Formula:C15H24N4O2
InChI:InChI=1S/C15H24N4O2/c1-15(2,3)21-14(20)18-11-6-9-19(10-7-11)13-12(16)5-4-8-17-13/h4-5,8,11H,6-7,9-10,16H2,1-3H3,(H,18,20)
InChI key:InChIKey=JGSKNOUXMUNRPW-UHFFFAOYSA-N
SMILES:NC1=C(N=CC=C1)N2CCC(NC(OC(C)(C)C)=O)CC2
Synonyms:- 1,1-Dimethylethyl N-[1-(3-amino-2-pyridinyl)-4-piperidinyl]carbamate
- Carbamic acid, N-[1-(3-amino-2-pyridinyl)-4-piperidinyl]-, 1,1-dimethylethyl ester
- tert-Butyl 1-(3-aminopyridin-2-yl)piperidin-4-ylcarbamate
- tert-butyl n-[1-(3-aminopyridin-2-yl)piperidin-4-yl]carbamate
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery