CAS 102368-18-3
:4,4,6-Trimethyl-1,3-dioxane-2-thione
Description:
4,4,6-Trimethyl-1,3-dioxane-2-thione is a chemical compound characterized by its unique structure, which includes a dioxane ring and a thione functional group. This compound features three methyl groups attached to the dioxane ring, contributing to its steric bulk and potentially influencing its reactivity and solubility. The presence of the thione group indicates that it contains a sulfur atom double-bonded to a carbon atom, which can impart specific chemical properties, such as nucleophilicity and the ability to participate in various chemical reactions. Typically, compounds like this may exhibit moderate polarity due to the dioxane structure, which can affect their solubility in organic solvents. Additionally, the compound may have applications in organic synthesis, particularly in the development of pharmaceuticals or agrochemicals, owing to its functional groups. Safety data should be consulted for handling and storage, as compounds with sulfur and carbonyl functionalities can sometimes pose health risks. Overall, 4,4,6-Trimethyl-1,3-dioxane-2-thione is a versatile compound with potential utility in various chemical applications.
Formula:C7H12O2S
InChI:InChI=1S/C7H12O2S/c1-5-4-7(2,3)9-6(10)8-5/h5H,4H2,1-3H3
InChI key:InChIKey=UKKXYMSTFJDDMV-UHFFFAOYSA-N
SMILES:CC1(C)CC(C)OC(=S)O1
Synonyms:- 4,4,6-Trimethyl-1,3-dioxane-2-thione
- 1,3-Dioxane-2-thione, 4,4,6-trimethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
