
CAS 1023812-03-4
:1,6-Dihydro-2-(4-morpholinyl)-6-oxo-5-pyrimidinecarboxylic acid
Description:
1,6-Dihydro-2-(4-morpholinyl)-6-oxo-5-pyrimidinecarboxylic acid is a chemical compound characterized by its pyrimidine core, which features a carboxylic acid functional group and a morpholine substituent. This compound typically exhibits properties associated with heterocyclic compounds, including potential solubility in polar solvents due to the presence of the carboxylic acid and morpholine groups. The morpholine moiety may contribute to its biological activity, as morpholines are often found in pharmaceuticals and can enhance interactions with biological targets. The presence of the keto group (6-oxo) suggests potential reactivity, possibly allowing for further derivatization or participation in chemical reactions. Additionally, the compound may exhibit specific pKa values, influencing its ionization state in various pH environments, which is crucial for its solubility and biological activity. Overall, this compound's unique structure may confer interesting pharmacological properties, making it a subject of interest in medicinal chemistry and drug development.
Formula:C9H11N3O4
InChI:InChI=1S/C9H11N3O4/c13-7-6(8(14)15)5-10-9(11-7)12-1-3-16-4-2-12/h5H,1-4H2,(H,14,15)(H,10,11,13)
InChI key:InChIKey=VEFKRLZIHUEHGH-UHFFFAOYSA-N
SMILES:O=C1NC(=NC=C1C(O)=O)N2CCOCC2
Synonyms:- 5-Pyrimidinecarboxylic acid, 1,6-dihydro-2-(4-morpholinyl)-6-oxo-
- 1,6-Dihydro-2-(4-morpholinyl)-6-oxo-5-pyrimidinecarboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.