
CAS 1023812-21-6
:4-Chloro-N,N-dimethyl-6-quinolinesulfonamide
Description:
4-Chloro-N,N-dimethyl-6-quinolinesulfonamide is a chemical compound characterized by its quinoline structure, which is a bicyclic aromatic compound containing a nitrogen atom. This substance features a sulfonamide functional group, which is known for its antibacterial properties, and a chloro substituent that can influence its reactivity and biological activity. The presence of dimethyl groups attached to the nitrogen atom contributes to its lipophilicity, potentially enhancing its ability to penetrate biological membranes. This compound may exhibit various pharmacological activities, making it of interest in medicinal chemistry. Its specific applications and efficacy would depend on further studies, including its interaction with biological targets and its overall toxicity profile. As with many sulfonamides, it may also be subject to regulatory scrutiny due to potential side effects or allergic reactions in certain individuals. Proper handling and safety measures are essential when working with this compound in a laboratory setting.
Formula:C11H11ClN2O2S
InChI:InChI=1S/C11H11ClN2O2S/c1-14(2)17(15,16)8-3-4-11-9(7-8)10(12)5-6-13-11/h3-7H,1-2H3
InChI key:InChIKey=GRZDDVQMJJHZPG-UHFFFAOYSA-N
SMILES:ClC=1C2=C(C=CC(S(N(C)C)(=O)=O)=C2)N=CC1
Synonyms:- 4-Chloro-N,N-dimethyl-6-quinolinesulfonamide
- 6-Quinolinesulfonamide, 4-chloro-N,N-dimethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.