CymitQuimica logo

CAS 1023813-21-9

:

3,6-Dichloropyrazine-2-carboxaMide

Description:
3,6-Dichloropyrazine-2-carboxamide is a chemical compound characterized by its pyrazine ring structure, which is a six-membered aromatic ring containing two nitrogen atoms at the 1 and 4 positions. The presence of two chlorine atoms at the 3 and 6 positions of the pyrazine ring contributes to its reactivity and potential biological activity. The carboxamide functional group at the 2 position enhances its solubility in polar solvents and may influence its interactions in biological systems. This compound is often studied for its potential applications in pharmaceuticals and agrochemicals, particularly due to its ability to act as a building block in the synthesis of more complex molecules. Its unique structure may also impart specific properties such as antimicrobial or herbicidal activity, making it of interest in various fields of research. Safety and handling precautions should be observed, as with many chlorinated compounds, due to potential toxicity and environmental impact.
Formula:C5H3Cl2N3O
InChI:InChI=1S/C5H3Cl2N3O/c6-2-1-9-4(7)3(10-2)5(8)11/h1H,(H2,8,11)
InChI key:ZEJGTWZTXZLSLR-UHFFFAOYSA-N
SMILES:C1=C(N=C(C(=N1)Cl)C(=O)N)Cl
Found 4 products.