
CAS 1023813-53-7
:6-Chloro-N-methyl-2-(trifluoromethyl)-4-pyrimidinamine
Description:
6-Chloro-N-methyl-2-(trifluoromethyl)-4-pyrimidinamine is a chemical compound characterized by its pyrimidine ring structure, which is a six-membered aromatic heterocycle containing nitrogen atoms. The presence of a chloro group at the 6-position and a trifluoromethyl group at the 2-position significantly influences its chemical properties, including its reactivity and polarity. The N-methyl substitution enhances its lipophilicity, potentially affecting its bioavailability and interaction with biological systems. This compound may exhibit various biological activities, making it of interest in pharmaceutical research. Its trifluoromethyl group can also contribute to increased metabolic stability and altered pharmacokinetics. The compound's CAS number, 1023813-53-7, allows for its identification in chemical databases and literature. Overall, the unique combination of functional groups in 6-Chloro-N-methyl-2-(trifluoromethyl)-4-pyrimidinamine suggests potential applications in medicinal chemistry and agrochemicals, warranting further investigation into its properties and uses.
Formula:C6H5ClF3N3
InChI:InChI=1S/C6H5ClF3N3/c1-11-4-2-3(7)12-5(13-4)6(8,9)10/h2H,1H3,(H,11,12,13)
InChI key:InChIKey=SAGGJJYJLWSBIG-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C=1N=C(NC)C=C(Cl)N1
Synonyms:- 4-Pyrimidinamine, 6-chloro-N-methyl-2-(trifluoromethyl)-
- 6-Chloro-N-methyl-2-(trifluoromethyl)-4-pyrimidinamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.