CymitQuimica logo

CAS 1023817-20-0

:

4-Hydrazinyl-2-pyridinecarboxylic acid

Description:
4-Hydrazinyl-2-pyridinecarboxylic acid is an organic compound characterized by the presence of a hydrazine functional group and a pyridine ring. It features a carboxylic acid group attached to the pyridine, which contributes to its acidic properties. The compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the carboxylic acid group. Its hydrazine moiety can participate in various chemical reactions, including condensation and oxidation, making it a potential candidate for applications in pharmaceuticals and agrochemicals. The compound may also exhibit biological activity, which could be of interest in medicinal chemistry. Additionally, the presence of nitrogen in both the hydrazine and pyridine structures may influence its reactivity and interaction with other chemical species. Safety precautions should be taken when handling this compound, as hydrazines are generally considered to be hazardous. Overall, 4-Hydrazinyl-2-pyridinecarboxylic acid is a versatile compound with potential applications in various fields of chemistry.
Formula:C6H7N3O2
InChI:InChI=1S/C6H7N3O2/c7-9-4-1-2-8-5(3-4)6(10)11/h1-3H,7H2,(H,8,9)(H,10,11)
InChI key:InChIKey=VXZWREDNXTWVCA-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=CC(NN)=CC=N1
Synonyms:
  • 4-Hydrazinyl-2-pyridinecarboxylic acid
  • 2-Pyridinecarboxylic acid, 4-hydrazinyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.