CAS 1023850-59-0

2-Amino-5,6-dihydro-5-(2-methylpropyl)-7(4H)-benzothiazolone

Description:

2-Amino-5,6-dihydro-5-(2-methylpropyl)-7(4H)-benzothiazolone is a chemical compound characterized by its unique structure, which includes a benzothiazole ring fused with a dihydro moiety and an amino group. This compound typically exhibits properties associated with both amines and heterocycles, such as potential basicity due to the amino group and the ability to participate in various chemical reactions, including nucleophilic substitutions and condensation reactions. The presence of the 2-methylpropyl substituent contributes to its hydrophobic character, which may influence its solubility in organic solvents compared to water. Additionally, benzothiazole derivatives often display biological activity, making this compound of interest in medicinal chemistry and drug development. Its specific reactivity and interactions can vary based on the functional groups present, and it may serve as a precursor or intermediate in the synthesis of more complex molecules. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.

Formula: C₁₁H₁₆N₂OS

InChI: InChI=1S/C11H16N2OS/c1-6(2)3-7-4-8-10(9(14)5-7)15-11(12)13-8/h6-7H,3-5H2,1-2H3,(H2,12,13)

InChI key: InChIKey=GAUUPODYGAUQPH-UHFFFAOYSA-N

SMILES: O=C1C2=C(CC(CC(C)C)C1)N=C(N)S2

Synonyms:

• 7(4H)-Benzothiazolone, 2-amino-5,6-dihydro-5-(2-methylpropyl)-
• 2-Amino-5,6-dihydro-5-(2-methylpropyl)-7(4H)-benzothiazolone

2-Amino-5-(2-methylpropyl)-4,5,6-trihydrobenzothiazol-7-one

CAS: 1023850-59-0

Please enquire for more information about 2-Amino-5-(2-methylpropyl)-4,5,6-trihydrobenzothiazol-7-one including the price, delivery time and more detailed product information at the technical inquiry form on this page

Formula: C₁₁H₁₆N₂OS

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 224.32 g/mol

Ref: 3D-FA169620