CAS 1023888-31-4

1-(Methoxymethyl)cyclobutanemethanamine

Description:

1-(Methoxymethyl)cyclobutanemethanamine, identified by its CAS number 1023888-31-4, is an organic compound characterized by its unique structure that includes a cyclobutane ring and an amine functional group. This compound features a methoxymethyl substituent, which contributes to its reactivity and potential applications in organic synthesis. The presence of the amine group suggests that it may exhibit basic properties and can participate in various chemical reactions, such as nucleophilic substitutions or coupling reactions. Additionally, the cyclobutane ring introduces strain, which can influence the compound's stability and reactivity. The methoxy group may also enhance solubility in organic solvents and affect the compound's overall polarity. While specific physical properties such as boiling point, melting point, and solubility are not detailed here, compounds of this nature typically exhibit moderate volatility and can be utilized in pharmaceutical or agrochemical applications due to their structural features. Further studies would be necessary to fully elucidate its properties and potential uses in various chemical contexts.

Formula: C₇H₁₅NO

InChI: InChI=1S/C7H15NO/c1-9-6-7(5-8)3-2-4-7/h2-6,8H2,1H3

InChI key: InChIKey=XVJNIDSLCWMUBC-UHFFFAOYSA-N

SMILES: C(OC)C1(CN)CCC1

Synonyms:

• 1-(Methoxymethyl)cyclobutanemethanamine
• [1-(Methoxymethyl)cyclobutyl]methanamine
• Cyclobutanemethanamine, 1-(methoxymethyl)-
• 1-Aminomethyl-1-(methoxymethyl)cyclobutane

[1-(Methoxymethyl)cyclobutyl]methanamine

CAS: 1023888-31-4

Versatile small molecule scaffold

Formula: C₇H₁₅NO

Purity: Min. 95%

Molecular weight: 129.2 g/mol

Ref: 3D-YQB88831