CAS 10239-34-6: N,N'-bis(phenylmethyl)-1,3-Propanediamine
Description:N,N'-bis(phenylmethyl)-1,3-propanediamine, with the CAS number 10239-34-6, is an organic compound characterized by its structure, which features two phenylmethyl groups attached to a 1,3-propanediamine backbone. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and temperature. It exhibits amine characteristics, including the ability to form hydrogen bonds, which can influence its solubility in various solvents. The presence of the phenyl groups contributes to its hydrophobic nature, while the amine functional groups can engage in various chemical reactions, such as alkylation or acylation. N,N'-bis(phenylmethyl)-1,3-propanediamine may be utilized in organic synthesis, particularly in the preparation of more complex molecules or as a ligand in coordination chemistry. Its potential applications in pharmaceuticals and materials science are also of interest, given its structural properties. However, safety data should be consulted for handling and exposure risks, as with any chemical substance.
Formula:C17H22N2
InChI:InChI=1/C17H22N2/c1-3-8-16(9-4-1)14-18-12-7-13-19-15-17-10-5-2-6-11-17/h1-6,8-11,18-19H,7,12-15H2
- Synonyms:
- N,N’-二苄基-1,3-丙二胺
- N,N'-dibenzylpropane-1,3-diamine
