CAS 1023919-67-6

1-[(3,4-Dimethoxyphenyl)methyl]-3-oxo-2-piperazineacetic acid

Description:

1-[(3,4-Dimethoxyphenyl)methyl]-3-oxo-2-piperazineacetic acid, with the CAS number 1023919-67-6, is a chemical compound characterized by its piperazine core, which is a six-membered heterocyclic structure containing two nitrogen atoms. This compound features a 3,4-dimethoxyphenyl group, indicating the presence of two methoxy (-OCH3) substituents on a phenyl ring, contributing to its lipophilicity and potential biological activity. The presence of a keto group (3-oxo) and a carboxylic acid moiety (acetic acid) suggests that it may exhibit acidic properties and could participate in various chemical reactions, such as esterification or amidation. The structural arrangement allows for potential interactions with biological targets, making it of interest in medicinal chemistry. Its solubility, stability, and reactivity would depend on the specific conditions, such as pH and solvent, which are crucial for its application in pharmaceutical research. Overall, this compound's unique structure may confer specific pharmacological properties, warranting further investigation.

Formula: C₁₅H₂₀N₂O₅

InChI: InChI=1S/C15H20N2O5/c1-21-12-4-3-10(7-13(12)22-2)9-17-6-5-16-15(20)11(17)8-14(18)19/h3-4,7,11H,5-6,8-9H2,1-2H3,(H,16,20)(H,18,19)

InChI key: InChIKey=FDEWUQADCXNEKR-UHFFFAOYSA-N

SMILES: C(N1C(CC(O)=O)C(=O)NCC1)C2=CC(OC)=C(OC)C=C2

Synonyms:

• 2-Piperazineacetic acid, 1-[(3,4-dimethoxyphenyl)methyl]-3-oxo-
• 2-[1-[(3,4-Dimethoxyphenyl)methyl]-3-oxopiperazin-2-yl]acetic acid
• 1-[(3,4-Dimethoxyphenyl)methyl]-3-oxo-2-piperazineacetic acid