CAS 102394-28-5
:methyl 4-hydroxy-2-{[(4-methoxy-6-methyl-1,3,5-triazin-2-yl)carbamoyl]sulfamoyl}benzoate
Description:
Methyl 4-hydroxy-2-{[(4-methoxy-6-methyl-1,3,5-triazin-2-yl)carbamoyl]sulfamoyl}benzoate, with CAS number 102394-28-5, is a chemical compound characterized by its complex structure, which includes a benzoate moiety, a sulfamoyl group, and a triazine derivative. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, contributing to its potential biological activity. The presence of the hydroxyl group suggests it may engage in hydrogen bonding, enhancing its solubility in polar solvents. The methoxy and methyl groups can influence its lipophilicity and overall reactivity. As a sulfamoyl derivative, it may possess antimicrobial properties, making it of interest in pharmaceutical applications. Additionally, the triazine ring can impart stability and may be involved in various chemical reactions, including nucleophilic substitutions. Overall, this compound's unique structural features suggest potential utility in medicinal chemistry and agrochemical formulations, although specific applications would depend on further research and characterization.
Formula:C14H15N5O7S
InChI:InChI=1/C14H15N5O7S/c1-7-15-12(18-14(16-7)26-3)17-13(22)19-27(23,24)10-6-8(20)4-5-9(10)11(21)25-2/h4-6,20H,1-3H3,(H2,15,16,17,18,19,22)
SMILES:Cc1nc(=NC(=NS(=O)(=O)c2cc(ccc2C(=O)OC)O)O)[nH]c(n1)OC
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
Methyl 4-hydroxy-2-(N-((4-methoxy-6-methyl-1,3,5-triazin-2-yl)carbamoyl)sulfamoyl)benzoate
CAS:Formula:C14H15N5O7SColor and Shape:SolidMolecular weight:397.3632


