CAS 102396-24-7
:JASPLAKINOLIDE
Description:
Jasplakinolide is a cyclic peptide derived from the marine sponge *Jaspis johnstoni*. It is known for its ability to bind to actin filaments, thereby stabilizing them and preventing depolymerization, which makes it a valuable tool in cell biology for studying cytoskeletal dynamics. The compound exhibits a unique structure characterized by a cyclic arrangement of amino acids, contributing to its biological activity. Jasplakinolide has been shown to influence various cellular processes, including cell motility, shape, and division, by modulating the actin cytoskeleton. Additionally, it has potential applications in cancer research due to its effects on cell proliferation and apoptosis. The substance is typically used in laboratory settings, and its effects can vary depending on concentration and cell type. As with many bioactive compounds, careful consideration of its pharmacological properties and potential cytotoxicity is essential when designing experiments. Overall, jasplakinolide serves as an important tool for researchers investigating the complexities of cellular architecture and function.
Formula:C36H45BrN4O6
InChI:InChI=1/C36H45BrN4O6/c1-20-15-21(2)17-23(4)47-32(43)19-30(25-11-13-26(42)14-12-25)40-35(45)31(18-28-27-9-7-8-10-29(27)39-33(28)37)41(6)36(46)24(5)38-34(44)22(3)16-20/h7-15,21-24,30-31,39,42H,16-19H2,1-6H3,(H,38,44)(H,40,45)/b20-15+/t21-,22-,23-,24-,30+,31+/m0/s1
Synonyms:- Jasplakinolide, Jaspis Johnstoni
- (15E)-7-[(2-bromo-1H-indol-3-yl)methyl]-4-(4-hydroxyphenyl)-8,10,13,15,17,19-hexamethyl-1-oxa-5,8,11-triazacyclononadec-15-ene-2,6,9,12-tetrone
- (4R,7R,10S,13R,15E,17R,19S)-7-[(2-bromo-1H-indol-3-yl)methyl]-4-(4-hydroxyphenyl)-8,10,13,15,17,19-hexamethyl-1-oxa-5,8,11-triazacyclononadec-15-ene-2,6,9,12-tetrone
- (4R,7R,10S,13S,15E,17R,19S)-7-[(2-bromo-1H-indol-3-yl)methyl]-4-(4-hydroxyphenyl)-8,10,13,15,17,19-hexamethyl-1-oxa-5,8,11-triazacyclononadec-15-ene-2,6,9,12-tetrone
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Jasplakinolide
CAS:<p>Jasplakinolide(Jaspamide), a naturally occurring cyclic peptide from marine sponges, is a potent inducer of actin polymerization.Jasplakinolide exhibits</p>Formula:C36H45BrN4O6Purity:98%Color and Shape:SolidMolecular weight:709.67Jasplakinolide
CAS:Formula:C36H45BrN4O6Purity:≥ 97.0%Color and Shape:Off-white to faint beige solid or filmMolecular weight:709.7Jasplakinolide
CAS:Controlled ProductFormula:C36H45BrN4O6Color and Shape:White To Light YellowMolecular weight:709.67Jasplakinolide
CAS:<p>Jasplakinolide is a cyclodepsipeptide, which is isolated from marine sponge species, particularly of the genus Jaspis. It functions by binding to actin, a critical component of cellular cytoskeletons, where it induces polymerization and stabilization of actin filaments. This action results in the disruption of normal actin dynamics, impeding processes such as cell motility and division.</p>Formula:C36H45BrN4O6Purity:Min. 95%Color and Shape:PowderMolecular weight:709.67 g/mol




