CAS 1024-11-9
:4-(Methylamino)-1-(phenylmethyl)-4-piperidinecarboxamide
Description:
4-(Methylamino)-1-(phenylmethyl)-4-piperidinecarboxamide, also known by its CAS number 1024-11-9, is a chemical compound that belongs to the class of piperidine derivatives. This substance features a piperidine ring, which is a six-membered saturated nitrogen-containing heterocycle, substituted with a methylamino group and a phenylmethyl group. The presence of the carboxamide functional group indicates that it has the potential for hydrogen bonding, which can influence its solubility and reactivity. Typically, compounds of this nature may exhibit biological activity, making them of interest in medicinal chemistry and pharmacology. The molecular structure suggests that it could interact with various biological targets, potentially affecting neurotransmitter systems. Its physical properties, such as melting point, boiling point, and solubility, would depend on the specific arrangement of its substituents and the overall molecular conformation. As with many organic compounds, safety and handling precautions are essential due to potential toxicity or reactivity.
Formula:C14H21N3O
InChI:InChI=1S/C14H21N3O/c1-16-14(13(15)18)7-9-17(10-8-14)11-12-5-3-2-4-6-12/h2-6,16H,7-11H2,1H3,(H2,15,18)
InChI key:InChIKey=YSCWOBPZXSXBGB-UHFFFAOYSA-N
SMILES:C(N)(=O)C1(NC)CCN(CC2=CC=CC=C2)CC1
Synonyms:- 1-Benzyl-4-(methylamino)piperidine-4-carboxamide
- 4-(Methylamino)-1-(phenylmethyl)-4-piperidinecarboxamide
- 4-Piperidinecarboxamide, 4-(methylamino)-1-(phenylmethyl)-
- Isonipecotamide, 1-benzyl-4-(methylamino)-
- NSC 72994
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
4-Piperidinecarboxamide, 4-(methylamino)-1-(phenylmethyl)-
CAS:Formula:C14H21N3OMolecular weight:247.336
