CAS 1024-16-4
:1-benzyl-4-(ethylamino)piperidine-4-carbonitrile
Description:
1-Benzyl-4-(ethylamino)piperidine-4-carbonitrile, with the CAS number 1024-16-4, is a chemical compound that belongs to the class of piperidine derivatives. This substance features a piperidine ring, which is a six-membered saturated nitrogen-containing heterocycle, substituted with a benzyl group and an ethylamino group. The presence of the carbonitrile functional group indicates that it contains a cyano group (-C≡N), which can influence its reactivity and polarity. The compound is typically characterized by its moderate to high lipophilicity due to the aromatic benzyl group, which may affect its biological activity and solubility in organic solvents. It may exhibit pharmacological properties, making it of interest in medicinal chemistry, particularly in the development of psychoactive or therapeutic agents. Safety data and handling precautions should be considered, as with any chemical substance, due to potential toxicity or reactivity. Overall, its unique structure suggests potential applications in various fields, including pharmaceuticals and organic synthesis.
Formula:C15H21N3
InChI:InChI=1/C15H21N3/c1-2-17-15(13-16)8-10-18(11-9-15)12-14-6-4-3-5-7-14/h3-7,17H,2,8-12H2,1H3
InChI key:InChIKey=NPYMJCBIPUSGQF-UHFFFAOYSA-N
SMILES:N(CC)C1(C#N)CCN(CC2=CC=CC=C2)CC1
Synonyms:- 1-Benzyl-4-(ethylamino)piperidine-4-carbonitrile
- Isonipecotonitrile, 1-benzyl-4-(ethylamino)-
- 4-(Ethylamino)-1-(phenylmethyl)-4-piperidinecarbonitrile
- NSC 72998
- 4-Piperidinecarbonitrile, 4-(ethylamino)-1-(phenylmethyl)-
- 1-Benzyl-4-cyano-4-(ethylamino)-piperidine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
