CAS 1024-31-3

Benzenesulfonic acid, 1-(phenylmethyl)hydrazide

Description:

Benzenesulfonic acid, 1-(phenylmethyl)hydrazide, also known by its CAS number 1024-31-3, is an organic compound characterized by the presence of both a hydrazide functional group and a benzenesulfonic acid moiety. This compound typically appears as a solid and is soluble in polar solvents, reflecting its hydrophilic characteristics due to the sulfonic acid group. The hydrazide functional group contributes to its reactivity, making it useful in various chemical reactions, including condensation and coupling reactions. The presence of the phenylmethyl group enhances its aromatic character, which can influence its stability and reactivity. Benzenesulfonic acid derivatives are often utilized in the synthesis of dyes, pharmaceuticals, and agrochemicals due to their ability to participate in electrophilic aromatic substitution reactions. Additionally, the compound may exhibit biological activity, making it of interest in medicinal chemistry. Safety data should be consulted for handling and potential hazards, as with any chemical substance.

Formula: C₁₃H₁₄N₂O₂S

InChI: InChI=1S/C13H14N2O2S/c14-15(11-12-7-3-1-4-8-12)18(16,17)13-9-5-2-6-10-13/h1-10H,11,14H2

InChI key: InChIKey=SLMRFRQCDOFFRU-UHFFFAOYSA-N

SMILES: S(N(CC1=CC=CC=C1)N)(=O)(=O)C2=CC=CC=C2

Synonyms:

• Benzenesulfonic acid, 1-(phenylmethyl)hydrazide
• Benzenesulfonic acid, 1-benzylhydrazide