CAS 1024-58-4
:N-Phenyl-N,N′-bis(trimethylsilyl)urea
Description:
N-Phenyl-N,N′-bis(trimethylsilyl)urea, with the CAS number 1024-58-4, is an organosilicon compound characterized by its urea functional group and the presence of trimethylsilyl groups. This compound typically appears as a white to off-white solid and is known for its relatively low solubility in water, while being soluble in organic solvents such as dichloromethane and tetrahydrofuran. The presence of the phenyl group contributes to its aromatic characteristics, which can influence its reactivity and stability. N-Phenyl-N,N′-bis(trimethylsilyl)urea is often utilized in organic synthesis, particularly in the field of organosilicon chemistry, where it can act as a reagent or a protective group for amines. Its trimethylsilyl groups enhance its stability and can facilitate various chemical transformations. Additionally, this compound may exhibit interesting properties such as thermal stability and potential applications in materials science, particularly in the development of silicone-based polymers and coatings. Proper handling and storage are essential due to its chemical nature and potential reactivity.
Formula:C13H24N2OSi2
InChI:InChI=1S/C13H24N2OSi2/c1-17(2,3)14-13(16)15(18(4,5)6)12-10-8-7-9-11-12/h7-11H,1-6H3,(H,14,16)
InChI key:InChIKey=DSSADGQCTDYPMP-UHFFFAOYSA-N
SMILES:N(C(N[Si](C)(C)C)=O)([Si](C)(C)C)C1=CC=CC=C1
Synonyms:- 1-Phenyl-1,3-bis(trimethylsilyl)urea
- Urea, 1-phenyl-1,3-bis(trimethylsilyl)-
- Urea, N-phenyl-N,N′-bis(trimethylsilyl)-
- N-Phenyl-N,N′-bis(trimethylsilyl)urea
- N,N′-Bis(trimethylsilyl)-N-phenylurea
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
