
CAS 1024-60-8
:Hexafluoro-1,4-naphthoquinone
Description:
Hexafluoro-1,4-naphthoquinone is a synthetic organic compound characterized by its unique structure, which includes a naphthoquinone framework substituted with six fluorine atoms. This compound is known for its strong electron-withdrawing properties due to the presence of fluorine, which enhances its reactivity and stability in various chemical environments. It typically appears as a solid at room temperature and is soluble in organic solvents. Hexafluoro-1,4-naphthoquinone is utilized in various applications, including as a reagent in organic synthesis and in the development of materials with specific electronic properties. Its fluorinated nature imparts distinctive characteristics, such as increased lipophilicity and altered spectral properties, making it valuable in research and industrial applications. Additionally, due to its potential toxicity and environmental impact, handling this compound requires appropriate safety precautions. Overall, hexafluoro-1,4-naphthoquinone is a notable compound in the field of fluorinated organic chemistry, with implications in both academic research and practical applications.
Formula:C10F6O2
InChI:InChI=1S/C10F6O2/c11-3-1-2(4(12)6(14)5(3)13)10(18)8(16)7(15)9(1)17
InChI key:InChIKey=ODOWBQJUWIEMDS-UHFFFAOYSA-N
SMILES:FC1=C2C(C(=O)C(F)=C(F)C2=O)=C(F)C(F)=C1F
Synonyms:- 1,4-Naphthoquinone, hexafluoro-
- Hexafluoro-1,4-naphthoquinone
- 1,4-Naphthalenedione, 2,3,5,6,7,8-hexafluoro-
- 2,3,5,6,7,8-Hexafluoro-1,4-naphthalenedione
- 1,4-Naphthoquinone, 2,3,5,6,7,8-hexafluoro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
