CAS 10240-08-1
:4-methyl-1-naphthol
Description:
4-Methyl-1-naphthol, with the CAS number 10240-08-1, is an organic compound that belongs to the naphthol family, which consists of a naphthalene ring substituted with a hydroxyl group and a methyl group. This compound typically appears as a solid, often in the form of white to pale yellow crystals or powder. It is characterized by its aromatic structure, which contributes to its stability and reactivity. 4-Methyl-1-naphthol is known for its moderate solubility in organic solvents such as ethanol and ether, while being less soluble in water due to its hydrophobic naphthalene core. The presence of the hydroxyl group imparts some polar characteristics, allowing for hydrogen bonding. This compound is utilized in various applications, including as an intermediate in organic synthesis, in dye production, and as a reagent in analytical chemistry. Additionally, it exhibits antimicrobial properties, making it of interest in pharmaceutical research. Safety precautions should be observed when handling this compound, as it may pose health risks if ingested or inhaled.
Formula:C11H10O
InChI:InChI=1/C11H10O/c1-8-6-7-11(12)10-5-3-2-4-9(8)10/h2-7,12H,1H3
InChI key:InChIKey=ZSUDUDXOEGHEJR-UHFFFAOYSA-N
SMILES:CC=1C2=C(C(O)=CC1)C=CC=C2
Synonyms:- 1-Hydroxy-4-methylnaphthalene
- 1-Naphthalenol, 4-ethyl-
- 1-Naphthalenol, 4-methyl-
- 1-Naphthol, 4-methyl-
- 4-Methyl-1-naphthalenol
- 4-Methylnaphthalen-1-Ol
- 4-Methyl-1-naphthol
- 4-Methyl-1-napthtalenol
- 4-Methylnaphthalene-1-ol
- Einecs 233-573-2
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
4-Methyl-1-naphthalenol
CAS:Formula:C11H10OPurity:97%Color and Shape:SolidMolecular weight:158.19654-Methyl-1-naphthol
CAS:4-Methyl-1-naphtholPurity:97%Color and Shape:SolidMolecular weight:158.20g/mol4-Methylnaphthalen-1-ol
CAS:4-Methylnaphthalen-1-ol is a binder that, when mixed with other organic materials, can be used to form a film. It can be used to bind many different types of sensitive material, including those that are heat-sensitive and cannot withstand high temperatures or those that are supercooled at low temperatures. 4-Methylnaphthalen-1-ol has been shown to react with alkylating agents such as diazo and naphthalenesulfonamide in the presence of iron catalyst and produce a high yield of products. These products have potential use in pharmaceuticals, plastics, rubber processing, and other industries.Formula:C11H10OPurity:Min. 95%Molecular weight:158.2 g/mol



