CymitQuimica logo

CAS 1024011-04-8

:

3,7-Diazabicyclo[3.3.1]nonane, 3-(phenylmethyl)-, hydrochloride (1:2)

Description:
3,7-Diazabicyclo[3.3.1]nonane, 3-(phenylmethyl)-, hydrochloride (1:2), commonly referred to as a bicyclic amine, is a chemical compound characterized by its bicyclic structure that includes two nitrogen atoms within a nonane framework. This compound features a phenylmethyl group, which contributes to its unique properties and potential applications. As a hydrochloride salt, it is typically encountered in a solid form, exhibiting increased solubility in water compared to its free base counterpart. The presence of the diazabicyclo structure imparts basicity to the compound, making it a potential candidate for various chemical reactions and applications in medicinal chemistry. Its unique structure may also influence its pharmacological properties, potentially making it relevant in the development of therapeutic agents. Safety and handling precautions should be observed, as with many nitrogen-containing compounds, due to potential toxicity or reactivity. Further studies would be necessary to fully elucidate its biological activity and potential uses in various fields.
Formula:C14H20N2·2ClH
InChI:InChI=1S/C14H20N2.2ClH/c1-2-4-12(5-3-1)9-16-10-13-6-14(11-16)8-15-7-13;;/h1-5,13-15H,6-11H2;2*1H
InChI key:InChIKey=LXBMBDCFFBMYBP-UHFFFAOYSA-N
SMILES:C(N1CC2CC(C1)CNC2)C3=CC=CC=C3.Cl
Synonyms:
  • 3,7-Diazabicyclo[3.3.1]nonane, 3-(phenylmethyl)-, hydrochloride (1:2)
  • 3-Benzyl-3,7-diazabicyclo[3.3.1]nonane dihydrochloride
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.