CymitQuimica logo

CAS 1024054-68-9

:

methyl 2-aminobenzo[d]thiazole-4-carboxylate

Description:
Methyl 2-aminobenzo[d]thiazole-4-carboxylate is an organic compound characterized by its unique structure, which includes a thiazole ring fused with a benzene ring, along with an amino group and a carboxylate ester functional group. This compound typically exhibits properties such as moderate solubility in polar organic solvents and potential reactivity due to the presence of the amino and carboxylate groups, which can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. The thiazole moiety contributes to its biological activity, making it of interest in medicinal chemistry for potential pharmaceutical applications. Additionally, the compound may exhibit fluorescence properties, which can be useful in analytical chemistry and biological imaging. Its molecular structure allows for various derivatives to be synthesized, potentially enhancing its activity or altering its solubility and stability. Overall, methyl 2-aminobenzo[d]thiazole-4-carboxylate is a versatile compound with applications in research and development within the fields of organic synthesis and drug discovery.
Formula:C9H8N2O2S
InChI:InChI=1S/C9H8N2O2S/c1-13-8(12)5-3-2-4-6-7(5)11-9(10)14-6/h2-4H,1H3,(H2,10,11)
InChI key:JWSQSUAAMGQUJI-UHFFFAOYSA-N
SMILES:COC(=O)C1=C2C(=CC=C1)SC(=N2)N
Synonyms:
  • ethyl 2-aminobenzo[d]thiazole-4-carboxylate
  • 4-Benzothiazolecarboxylic acid, 2-amino-, methyl ester
  • Methyl 2-aminobenzo[d]thiazol-4-carboxylate
  • methyl 2-aminobenzo[d]thiazole-4-carboxylate
  • Methyl 2-amino-1,3-benzothiazole-4-carboxylate
  • 2-Amino-4-benzothiazolecarboxylic acid methyl ester
Found 4 products.