CymitQuimica logo

CAS 102408-26-4

:

N,3-Dimethyl-3H-imidazo[4,5-f]quinolin-2-amine

Description:
N,3-Dimethyl-3H-imidazo[4,5-f]quinolin-2-amine is a heterocyclic organic compound characterized by its complex bicyclic structure, which includes both imidazole and quinoline moieties. This compound features a dimethyl substitution at the nitrogen atom in the imidazole ring, contributing to its unique chemical properties. It is typically a solid at room temperature and may exhibit moderate solubility in polar organic solvents. The presence of nitrogen atoms in its structure can impart basicity, allowing it to participate in various chemical reactions, including nucleophilic substitutions and coordination with metal ions. Additionally, compounds of this type may exhibit biological activity, making them of interest in medicinal chemistry and drug development. The specific interactions and reactivity of N,3-Dimethyl-3H-imidazo[4,5-f]quinolin-2-amine can vary based on its environment and the presence of other functional groups. Overall, its structural features and potential biological relevance make it a compound of interest in both synthetic and pharmaceutical chemistry.
Formula:C12H12N4
InChI:InChI=1S/C12H12N4/c1-13-12-15-11-8-4-3-7-14-9(8)5-6-10(11)16(12)2/h3-7H,1-2H3,(H,13,15)
InChI key:InChIKey=KDCAXDISXLLBJE-UHFFFAOYSA-N
SMILES:CN1C2=C(C=3C(C=C2)=NC=CC3)N=C1NC
Synonyms:
  • 3H-Imidazo[4,5-f]quinolin-2-amine, N,3-dimethyl-
  • N,3-dimethyl-3H-imidazo[4,5-f]quinolin-2-amine
  • N-Methyl-IQ
  • 3-Methyl-2-methylaminoimidazo[4,5-F]quinoline
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.