CymitQuimica logo

CAS 102408-29-7

:

1-Methyl-2-dimethylamino-imidazo[4,5-F]quinoline

Description:
1-Methyl-2-dimethylamino-imidazo[4,5-F]quinoline is a heterocyclic organic compound characterized by its complex structure, which includes an imidazoquinoline framework. This compound features a methyl group and a dimethylamino group, contributing to its unique chemical properties. It is typically a solid at room temperature and may exhibit a range of colors depending on its purity and form. The presence of the dimethylamino group suggests potential basicity, which can influence its reactivity and interactions with other chemical species. Additionally, the imidazoquinoline structure is known for its biological activity, making this compound of interest in medicinal chemistry and pharmacology. Its CAS number, 102408-29-7, allows for precise identification in chemical databases. The compound may also exhibit fluorescence properties, which can be useful in various applications, including imaging and sensing. Overall, 1-Methyl-2-dimethylamino-imidazo[4,5-F]quinoline is a significant compound in research, particularly in the fields of organic synthesis and drug development.
Formula:C13H14N4
InChI:InChI=1/C13H14N4/c1-16(2)13-15-11-7-6-10-9(5-4-8-14-10)12(11)17(13)3/h4-8H,1-3H3
SMILES:CN(C)c1nc2ccc3c(cccn3)c2n1C
Synonyms:
  • 1H-Imidazo(4,5-f)quinolin-2-amine, N,N,1-trimethyl-
  • N,N,1-Trimethyl-1H-imidazo(4,5-f)quinolin-2-amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.