CymitQuimica logo

CAS 10241-98-2

:

5-Chloro-2,3-dihydro-1H-indole-2-carboxylic acid

Description:
5-Chloro-2,3-dihydro-1H-indole-2-carboxylic acid is an organic compound characterized by its indole structure, which features a fused bicyclic system comprising a benzene ring and a pyrrole ring. The presence of a chlorine atom at the 5-position and a carboxylic acid functional group at the 2-position contributes to its chemical reactivity and potential biological activity. This compound is typically a white to off-white solid and is soluble in polar solvents, which may facilitate its use in various chemical reactions and applications. Its structure suggests potential applications in pharmaceuticals, particularly in the development of compounds with anti-inflammatory or antimicrobial properties. The compound's reactivity can be influenced by the electron-withdrawing nature of the chlorine atom and the acidic carboxyl group, making it a candidate for further derivatization in synthetic organic chemistry. As with many indole derivatives, it may also exhibit interesting interactions with biological targets, warranting further investigation into its pharmacological properties.
Formula:C9H8ClNO2
InChI:InChI=1S/C9H8ClNO2/c10-6-1-2-7-5(3-6)4-8(11-7)9(12)13/h1-3,8,11H,4H2,(H,12,13)
InChI key:InChIKey=FXZZXHFPSBXQKT-UHFFFAOYSA-N
SMILES:C(O)(=O)C1NC=2C(C1)=CC(Cl)=CC2
Synonyms:
  • 5-Chloro-2,3-dihydro-1H-indole-2-carboxylic acid
  • 1H-Indole-2-carboxylic acid, 5-chloro-2,3-dihydro-
Found 5 products.