CAS 102418-06-4
:neospiramycin
Description:
Neospiramycin is a macrolide antibiotic that is primarily derived from the fermentation of the bacterium *Streptomyces ambofaciens*. It is characterized by its ability to inhibit bacterial protein synthesis, making it effective against a variety of Gram-positive bacteria and some Gram-negative strains. Neospiramycin is particularly noted for its activity against respiratory pathogens and is often used in veterinary medicine, especially in livestock, to treat infections. The compound has a complex structure featuring a large lactone ring, which is typical of macrolides, and it possesses multiple hydroxyl and sugar moieties that contribute to its solubility and biological activity. Neospiramycin is generally administered orally and is known for its relatively low toxicity profile. However, like other antibiotics, it can lead to the development of resistance if misused. Its pharmacokinetics, including absorption, distribution, metabolism, and excretion, are influenced by its chemical structure, which affects its therapeutic efficacy and safety in clinical applications.
Formula:C36H62N2O11
InChI:InChI=1/C36H62N2O11/c1-21-19-25(17-18-39)34(49-36-33(43)31(38(7)8)32(42)24(4)47-36)35(44-9)27(40)20-29(41)45-22(2)13-11-10-12-14-28(21)48-30-16-15-26(37(5)6)23(3)46-30/h10-12,14,18,21-28,30-36,40,42-43H,13,15-17,19-20H2,1-9H3/b11-10+,14-12+/t21-,22-,23-,24-,25+,26+,27-,28+,30+,31+,32-,33-,34+,35+,36+/m1/s1
Synonyms:- [(4R,5S,6S,7R,9R,10R,11E,13E,16R)-6-{[(2S,3R,4S,5S,6R)-4-(dimethylamino)-3,5-dihydroxy-6-methyltetrahydro-2H-pyran-2-yl]oxy}-10-{[(2R,5S,6R)-5-(dimethylamino)-6-methyltetrahydro-2H-pyran-2-yl]oxy}-4-hydroxy-5-methoxy-9,16-dimethyl-2-oxooxacyclohexadeca-11,13-dien-7-yl]acetaldehyde (non-preferred name)
- Neospiramycin
- Spiramycin Impurity 1 (Neospiramycin)
- SpiramycinImpurity1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Ref: 4Z-S-437
Discontinued product
