CAS 102418-74-6: BIOTIN 4-AMIDOBENZOIC ACID SODIUM SALT
Description:Biotin 4-amidobenzoic acid sodium salt, identified by the CAS number 102418-74-6, is a chemical compound that combines the properties of biotin, a vital B-vitamin, with an amidobenzoic acid moiety. This compound is typically characterized by its role in biochemical applications, particularly in the field of molecular biology and biochemistry, where it serves as a useful reagent for labeling and detection purposes. It is soluble in water, which enhances its utility in various biological assays. The sodium salt form indicates that it is a stable, ionic compound, facilitating its use in aqueous environments. Biotin itself is known for its involvement in carboxylation reactions and is essential for the metabolism of fats, carbohydrates, and proteins. The incorporation of the amidobenzoic acid group may impart additional functionalities, such as improved binding properties or enhanced stability. Overall, this compound is significant in research and diagnostic applications, particularly in the development of biotinylated probes for studying biomolecular interactions.
Formula:C17H20N3NaO4S
InChI:InChI=1/C17H21N3O4S.Na/c21-14(18-11-7-5-10(6-8-11)16(22)23)4-2-1-3-13-15-12(9-25-13)19-17(24)20-15;/h5-8,12-13,15H,1-4,9H2,(H,18,21)(H,22,23)(H2,19,20,24);/q;+1/p-1/t12-,13-,15-;/m0./s1
- Synonyms:
- Sodium N-(+)-Biotinyl-4-Aminobenzoate
- N-(+)-Biotinyl-4-Aminobenzoic Acid Sodium Salt
- N-Biotinyl-P-Aminobenzoic Acid
- N-Biotinyl-P-Aminobenzoic Acid Sodium Salt
- Bioparticlesr From E. Coli K-12 Tetramet Hylrhodamin
- Biotin 4-Amidobenzoic Acid Sodium
- sodium 4-({5-[(3aS,4S,6aR)-2-oxohexahydro-1H-thieno[3,4-d]imidazol-4-yl]pentanoyl}amino)benzoate