CAS 10242-12-3
:5-Nitrobenzofuran-2-carboxylic acid
Description:
5-Nitrobenzofuran-2-carboxylic acid is an organic compound characterized by its fused benzofuran structure, which incorporates a nitro group and a carboxylic acid functional group. This compound typically appears as a solid and is known for its aromatic properties, which contribute to its stability and reactivity. The presence of the nitro group enhances its electrophilic character, making it useful in various chemical reactions, including nitration and coupling reactions. The carboxylic acid group provides acidic properties, allowing for potential interactions with bases and facilitating the formation of salts or esters. This compound is often utilized in organic synthesis and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. Additionally, its unique structure may impart specific biological activities, making it of interest in medicinal chemistry. Safety data should be consulted for handling, as compounds with nitro groups can pose health risks. Overall, 5-Nitrobenzofuran-2-carboxylic acid is a versatile compound with significant applications in chemical research and industry.
Formula:C9H4NO5
InChI:InChI=1/C9H5NO5/c11-9(12)8-4-5-3-6(10(13)14)1-2-7(5)15-8/h1-4H,(H,11,12)/p-1
SMILES:c1cc2c(cc1N(=O)=O)cc(C(=O)[O-])o2
Synonyms:- 5-Nitro-1-Benzofuran-2-Carboxylic Acid
- 5-Nitro-1-Benzofuran-2-Carboxylate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2-Benzofurancarboxylic acid, 5-nitro-
CAS:Formula:C9H5NO5Purity:97%Color and Shape:SolidMolecular weight:207.13975-Nitrobenzofuran-2-carboxylic acid
CAS:5-Nitrobenzofuran-2-carboxylic acidFormula:C9H5NO5Purity:≥95%Color and Shape: light beige/brown solidMolecular weight:207.14g/mol5-Nitrobenzofuran-2-carboxylic Acid
CAS:Formula:C9H5NO5Purity:>98.0%(GC)(T)Color and Shape:White to Orange to Green powder to crystalMolecular weight:207.145-Nitrobenzofuran-2-carboxylic acid
CAS:Formula:C9H5NO5Purity:98%Color and Shape:Solid, Crystalline PowderMolecular weight:207.1415-Nitrobenzofuran-2-carboxylic acid
CAS:5-Nitrobenzofuran-2-carboxylic acid is a chromophore with an orange-yellow color. This compound has been identified in soil and water samples, but it is not known to be produced by any living organism. It is possible that 5-nitrobenzofuran-2-carboxylic acid is produced by thermally or opportunistic bacteria, such as Chromobacterium violaceum, as a result of the oxidation of 5-nitrobenzofuran. The molecule's fluorescence can be quenched by chloroformate, which suggests that this compound may play a role in the synthesis of other aromatic compounds. The enzyme ethyl bromoacetate alkylates 5-nitrobenzofuran-2-carboxylic acid and produces ethyl 2-(5'-nitrobenzo[d][1,3]dioxol-5'-yl)acetate.
Formula:C9H5NO5Purity:Min. 95%Molecular weight:207.14 g/mol




