CAS 102421-84-1
:(3R,4R)-3,4-dihydrodibenzo[a,h]acridine-3,4-diol
Description:
(3R,4R)-3,4-dihydrodibenzo[a,h]acridine-3,4-diol is a polycyclic aromatic compound characterized by its complex fused ring structure, which includes two benzene rings and an acridine moiety. This compound features hydroxyl (-OH) groups at the 3 and 4 positions, contributing to its potential reactivity and solubility in polar solvents. The stereochemistry indicated by the (3R,4R) configuration suggests specific spatial arrangements of the substituents, which can influence its biological activity and interactions with other molecules. As a derivative of dibenzo[a,h]acridine, it may exhibit properties relevant to medicinal chemistry, including potential antitumor or antimicrobial activities. The presence of the hydroxyl groups may also enhance its ability to form hydrogen bonds, affecting its solubility and interaction with biological targets. Overall, this compound's unique structure and functional groups make it a subject of interest in various fields, including organic synthesis and pharmacology.
Formula:C21H15NO2
InChI:InChI=1/C21H15NO2/c23-19-10-8-15-16(21(19)24)7-9-18-17(15)11-13-6-5-12-3-1-2-4-14(12)20(13)22-18/h1-11,19,21,23-24H/t19-,21-/m1/s1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
