CymitQuimica logo

CAS 1024240-73-0

:

N-(4-Phenoxyphenyl)benzeneethanamine

Description:
N-(4-Phenoxyphenyl)benzeneethanamine, identified by its CAS number 1024240-73-0, is an organic compound characterized by its amine functional group and aromatic structure. This compound features a benzeneethanamine backbone, which is substituted with a phenoxy group at the para position of the phenyl ring. The presence of both the amine and ether functionalities contributes to its potential reactivity and solubility properties. Typically, compounds of this nature may exhibit biological activity, making them of interest in medicinal chemistry and drug development. The molecular structure suggests that it may participate in hydrogen bonding due to the amine group, influencing its physical properties such as melting point and solubility in various solvents. Additionally, the aromatic rings can provide stability and contribute to the compound's electronic properties. Overall, N-(4-Phenoxyphenyl)benzeneethanamine represents a class of compounds that may have applications in pharmaceuticals or materials science, pending further investigation into its specific properties and potential uses.
Formula:C20H19NO
InChI:InChI=1S/C20H19NO/c1-3-7-17(8-4-1)15-16-21-18-11-13-20(14-12-18)22-19-9-5-2-6-10-19/h1-14,21H,15-16H2
InChI key:InChIKey=GUDHZZAXTMGZNF-UHFFFAOYSA-N
SMILES:O(C1=CC=C(NCCC2=CC=CC=C2)C=C1)C3=CC=CC=C3
Synonyms:
  • N-(4-Phenoxyphenyl)benzeneethanamine
  • Benzeneethanamine, N-(4-phenoxyphenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.