CAS 10243-15-9

3-BROMO-2-METHYL-BENZO[B]THIOPHENE

Description:

3-Bromo-2-methyl-benzo[b]thiophene is an organic compound characterized by its fused ring structure, which includes a thiophene ring and a benzene ring. The presence of a bromine atom at the 3-position and a methyl group at the 2-position on the benzo[b]thiophene framework contributes to its unique chemical properties. This compound is typically a solid at room temperature and may exhibit a range of colors depending on its purity and form. It is known for its potential applications in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals, due to the reactivity of the bromine substituent, which can participate in various coupling reactions. Additionally, the thiophene moiety can enhance the compound's electronic properties, making it of interest in materials science, particularly in organic electronics. As with many brominated compounds, it is essential to handle 3-bromo-2-methyl-benzo[b]thiophene with care, as it may pose environmental and health risks. Proper safety protocols should be followed during its use and disposal.

Formula: C₉H₇BrS

InChI: InChI=1/C9H7BrS/c1-6-9(10)7-4-2-3-5-8(7)11-6/h2-5H,1H3

SMILES: Cc1c(c2ccccc2s1)Br

Synonyms:

• 3-Bromo-2-Methyl-1-Benzothiophene

Benzo[b]thiophene, 3-bromo-2-methyl-

CAS: 10243-15-9

Formula: C₉H₇BrS

Purity: 98%

Color and Shape: Solid

Molecular weight: 227.1209

Ref: IN-DA0007GA

3-Bromo-2-methylbenzo[b]thiophene

CAS: 10243-15-9

3-Bromo-2-methylbenzo[b]thiophene

Purity: 98%

Molecular weight: 227.12g/mol

Ref: 54-OR94127

3-Bromo-2-methylbenzo[b]thiophene

CAS: 10243-15-9

Formula: C₉H₇BrS

Purity: 98%

Color and Shape: Solid

Molecular weight: 227.12

Ref: 10-F227616