CymitQuimica logo

CAS 102433-31-8

:

1,1-dimethyl-3-nitroso-3-[3-(trifluoromethyl)phenyl]urea

Description:
1,1-Dimethyl-3-nitroso-3-[3-(trifluoromethyl)phenyl]urea, with the CAS number 102433-31-8, is a chemical compound characterized by its unique structural features, including a urea functional group and a nitroso group. This compound contains a trifluoromethyl group, which is known for its electron-withdrawing properties, enhancing the compound's reactivity and potential applications in various chemical reactions. The presence of the nitroso group contributes to its potential as a nitrating agent or in the formation of other nitrogen-containing compounds. Typically, compounds of this nature may exhibit biological activity, making them of interest in pharmaceutical research. Additionally, the dimethyl substitution on the urea nitrogen atoms can influence solubility and stability in different solvents. Overall, the combination of these functional groups suggests that this compound may have applications in agrochemicals, pharmaceuticals, or as an intermediate in organic synthesis, although specific applications would depend on further research and testing.
Formula:C10H10F3N3O2
InChI:InChI=1/C10H10F3N3O2/c1-15(2)9(17)16(14-18)8-5-3-4-7(6-8)10(11,12)13/h3-6H,1-2H3
SMILES:CN(C)C(=O)N(c1cccc(c1)C(F)(F)F)N=O
Synonyms:
  • Urea, 1,1-dimethyl-3-nitroso-3-(alpha,alpha,alpha-trifluoro-m-tolyl)-
  • 1,1-Dimethyl-3-nitroso-3-(alpha,alpha,alpha-trifluoro-m-tolyl)urea
  • Nitrosofluometuron
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.