CAS 1024338-96-2
:4-Chloro-N-[[[3-(phenylmethoxy)-2-pyridinyl]amino]thioxomethyl]benzamide
Description:
4-Chloro-N-[[[3-(phenylmethoxy)-2-pyridinyl]amino]thioxomethyl]benzamide is a chemical compound characterized by its complex structure, which includes a chloro group, a benzamide moiety, and a thioxomethyl functional group. The presence of a pyridine ring contributes to its potential biological activity, as pyridine derivatives are often associated with various pharmacological properties. The compound's thioxomethyl group may enhance its reactivity and interaction with biological targets. Additionally, the phenylmethoxy substituent can influence its solubility and lipophilicity, affecting its absorption and distribution in biological systems. The chlorine atom introduces electronegativity, which can impact the compound's overall reactivity and stability. This compound may be of interest in medicinal chemistry and drug development, particularly in the context of designing agents with specific therapeutic effects. However, detailed studies would be necessary to elucidate its precise biological activity, mechanism of action, and potential applications in pharmaceuticals.
Formula:C20H16ClN3O2S
InChI:InChI=1S/C20H16ClN3O2S/c21-16-10-8-15(9-11-16)19(25)24-20(27)23-18-17(7-4-12-22-18)26-13-14-5-2-1-3-6-14/h1-12H,13H2,(H2,22,23,24,25,27)
InChI key:InChIKey=JPLUKBBTTHMBEE-UHFFFAOYSA-N
SMILES:N(C(NC(=O)C1=CC=C(Cl)C=C1)=S)C2=C(OCC3=CC=CC=C3)C=CC=N2
Synonyms:- Benzamide, 4-chloro-N-[[[3-(phenylmethoxy)-2-pyridinyl]amino]thioxomethyl]-
- 4-Chloro-N-[[[3-(phenylmethoxy)-2-pyridinyl]amino]thioxomethyl]benzamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.