CAS 102434-29-7
:3-(2-bromoethyl)-1-methyl-1-naphthalen-1-yl-urea
Description:
3-(2-Bromoethyl)-1-methyl-1-naphthalen-1-yl-urea, with the CAS number 102434-29-7, is an organic compound characterized by its unique structure that includes a naphthalene moiety, a urea functional group, and a bromoethyl substituent. This compound typically exhibits properties associated with both aromatic and aliphatic systems, which can influence its reactivity and solubility. The presence of the bromine atom suggests potential for nucleophilic substitution reactions, while the urea group may participate in hydrogen bonding, affecting its physical properties such as melting and boiling points. Additionally, the naphthalene ring contributes to its hydrophobic character, which may impact its solubility in various solvents. This compound may be of interest in medicinal chemistry and materials science due to its structural features, which could lead to specific biological activities or applications in polymer synthesis. As with many organic compounds, safety and handling precautions should be observed, particularly due to the presence of bromine, which can be hazardous.
Formula:C14H15BrN2O
InChI:InChI=1/C14H15BrN2O/c1-17(14(18)16-10-9-15)13-8-4-6-11-5-2-3-7-12(11)13/h2-8H,9-10H2,1H3,(H,16,18)
Synonyms:- Urea, 1-(2-bromoethyl)-3-methyl-3-(1-naphthyl)-
- 3-(2-Bromoethyl)-1-methyl-1-(1-naphthyl)urea
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
