
CAS 102439-97-4
:α,4,6-Trimethyl-2-pyridinemethanol
Description:
α,4,6-Trimethyl-2-pyridinemethanol is an organic compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features three methyl groups attached to the pyridine ring at the 4 and 6 positions, and a hydroxymethyl group at the 2 position, contributing to its unique chemical properties. It is typically a colorless to pale yellow liquid with a distinctive odor. The presence of the hydroxymethyl group makes it a potential candidate for various chemical reactions, including those involving alcohol functionalities. This compound may exhibit solubility in polar solvents due to the hydroxyl group, while the methyl groups can influence its hydrophobic characteristics. α,4,6-Trimethyl-2-pyridinemethanol is of interest in various fields, including pharmaceuticals and agrochemicals, due to its potential biological activity and utility as an intermediate in organic synthesis. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C9H13NO
InChI:InChI=1S/C9H13NO/c1-6-4-7(2)10-9(5-6)8(3)11/h4-5,8,11H,1-3H3
InChI key:InChIKey=YELQCKCQMQDNDM-UHFFFAOYSA-N
SMILES:C(C)(O)C1=CC(C)=CC(C)=N1
Synonyms:- α,4,6-Trimethyl-2-pyridinemethanol
- 2-Pyridinemethanol, α,4,6-trimethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.