CymitQuimica logo

CAS 102446-20-8

:

3-[(4-chlorophenyl)-phenyl-methoxy]-1-(2-methylpropyl)pyrrolidine hydr ochloride

Description:
3-[(4-Chlorophenyl)-phenyl-methoxy]-1-(2-methylpropyl)pyrrolidine hydrochloride, with the CAS number 102446-20-8, is a chemical compound characterized by its complex structure, which includes a pyrrolidine ring substituted with various functional groups. The presence of a methoxy group and a 4-chlorophenyl moiety contributes to its potential biological activity, possibly influencing its pharmacological properties. This compound is typically encountered as a hydrochloride salt, which enhances its solubility in water, making it suitable for various applications in medicinal chemistry and research. The molecular structure suggests potential interactions with biological targets, which may be of interest in the development of therapeutic agents. Additionally, the presence of the 2-methylpropyl group may affect the compound's lipophilicity and overall pharmacokinetic profile. As with many synthetic organic compounds, safety and handling precautions are essential due to potential toxicity or reactivity. Further studies would be necessary to elucidate its specific properties and potential applications in drug development or other fields.
Formula:C21H27Cl2NO
InChI:InChI=1/C21H26ClNO.ClH/c1-16(2)14-23-13-12-20(15-23)24-21(17-6-4-3-5-7-17)18-8-10-19(22)11-9-18;/h3-11,16,20-21H,12-15H2,1-2H3;1H
Synonyms:
  • AHR 179
  • Pyrrolidine, 3-(p-chloro-alpha-phenylbenzyloxy)-1-isobutyl-, hydrochloride
  • 3-(p-Chloro-alpha-phenylbenzyloxy)-1-isobutylpyrrolidine hydrochloride
  • 3-[(4-chlorophenyl)(phenyl)methoxy]-1-(2-methylpropyl)pyrrolidine hydrochloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.