CAS 10245-82-6
:2-(3,5-Dibromo-2-methoxyphenyl)-1H-pyrrole
Description:
2-(3,5-Dibromo-2-methoxyphenyl)-1H-pyrrole is an organic compound characterized by its unique structure, which includes a pyrrole ring and a substituted phenyl group. The presence of bromine atoms at the 3 and 5 positions of the phenyl ring enhances its reactivity and potential applications in various chemical reactions, including electrophilic substitution. The methoxy group at the 2-position of the phenyl ring contributes to the compound's solubility and electronic properties, making it a candidate for use in organic synthesis and materials science. This compound may exhibit interesting biological activities due to its structural features, which can influence interactions with biological targets. Additionally, the presence of halogens often imparts unique physical properties, such as increased density and altered melting and boiling points compared to non-halogenated analogs. Overall, 2-(3,5-Dibromo-2-methoxyphenyl)-1H-pyrrole is a versatile compound with potential applications in pharmaceuticals, agrochemicals, and advanced materials.
Formula:C11H9Br2NO
InChI:InChI=1S/C11H9Br2NO/c1-15-11-8(10-3-2-4-14-10)5-7(12)6-9(11)13/h2-6,14H,1H3
InChI key:InChIKey=JLXGOYFXOKFPKJ-UHFFFAOYSA-N
SMILES:O(C)C1=C(C=C(Br)C=C1Br)C2=CC=CN2
Synonyms:- 1H-Pyrrole, 2-(3,5-dibromo-2-methoxyphenyl)-
- 2-(2-Methoxy-3,5-dibromophenyl)pyrrole
- 2-(3,5-Dibromo-2-methoxyphenyl)-1H-pyrrole
- Pyrrole, 2-(3,5-dibromo-2-methoxyphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
