CymitQuimica logo

CAS 102458-70-8

:

2-(3,4-dimethoxybenzyl)piperidine

Description:
2-(3,4-Dimethoxybenzyl)piperidine is an organic compound characterized by its piperidine ring, which is a six-membered saturated nitrogen-containing heterocycle. The compound features a benzyl group substituted with two methoxy groups at the 3 and 4 positions, contributing to its unique chemical properties. This substitution pattern can influence the compound's solubility, reactivity, and biological activity. The presence of the piperidine moiety suggests potential applications in medicinal chemistry, as piperidine derivatives are often explored for their pharmacological properties. The methoxy groups can enhance lipophilicity and may also participate in hydrogen bonding interactions. Additionally, the compound's structure may allow for various synthetic modifications, making it a versatile building block in organic synthesis. Its specific interactions with biological targets would depend on the overall conformation and electronic properties imparted by the substituents. As with many organic compounds, safety and handling precautions should be observed, particularly in laboratory settings.
Formula:C14H21NO2
InChI:InChI=1/C14H21NO2/c1-16-13-7-6-11(10-14(13)17-2)9-12-5-3-4-8-15-12/h6-7,10,12,15H,3-5,8-9H2,1-2H3
SMILES:COc1ccc(CC2CCCCN2)cc1OC
Synonyms:
  • Piperidine, 2-[(3,4-Dimethoxyphenyl)Methyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.