CAS 10247-54-8: verticillatine
Description:Verticillatine is a chemical compound classified as a natural alkaloid, primarily derived from certain species of fungi, particularly those in the genus Verticillium. It is known for its complex molecular structure, which includes multiple rings and functional groups that contribute to its biological activity. Verticillatine exhibits notable pharmacological properties, including antimicrobial and cytotoxic effects, making it of interest in medicinal chemistry and drug development. The compound has been studied for its potential applications in treating various diseases, although its exact mechanisms of action are still under investigation. Additionally, verticillatine's solubility and stability can vary depending on environmental conditions, which may influence its efficacy in biological systems. As with many natural products, the extraction and purification processes are critical for obtaining verticillatine in a form suitable for research and potential therapeutic use. Overall, verticillatine represents a fascinating area of study within the field of natural product chemistry and pharmacology.
Formula:C25H27NO5
InChI:InChI=1/C25H27NO5/c1-30-22-9-7-18-20-14-17(13-16-4-2-3-11-26(16)20)31-23(28)10-6-15-5-8-21(27)19(12-15)24(18)25(22)29/h5-10,12,16-17,20,27,29H,2-4,11,13-14H2,1H3/b10-6-/t16-,17+,20+/m1/s1
- Synonyms:
- Lythran-12-one, 2',6''-dihydroxy-5''-methoxy-, (10alpha)-
- (10alpha,13Z)-2',6''-dihydroxy-5''-methoxylythran-12-one
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | Verticillatine REF: 3D-FV65804CAS: 10247-54-8 | Min. 95% | 147.00 €~627.00 € | Tue 25 Mar 25 |
![discount label](https://static.cymitquimica.com/public/img/discount.png)
Verticillatine
Ref: 3D-FV65804
25mg | 147.00 € | ||
50mg | 211.00 € | ||
100mg | 375.00 € | ||
250mg | 627.00 € |