CAS 10248-89-2
:N,N′-Bis(2-furanylmethyl)thiourea
Description:
N,N′-Bis(2-furanylmethyl)thiourea is an organic compound characterized by its unique structure, which includes two furanyl groups attached to a thiourea moiety. This compound typically appears as a solid and is known for its potential applications in various fields, including pharmaceuticals and materials science. The presence of the furanyl groups contributes to its reactivity and ability to participate in various chemical reactions, such as nucleophilic substitutions and polymerization processes. Additionally, thiourea derivatives are often recognized for their biological activity, which may include antimicrobial and anticancer properties. The compound's solubility can vary depending on the solvent, and it may exhibit specific optical properties due to the conjugated system formed by the furan rings. Safety data should be consulted for handling, as with many organic compounds, to ensure proper precautions are taken. Overall, N,N′-Bis(2-furanylmethyl)thiourea is a compound of interest for its chemical versatility and potential utility in research and industrial applications.
Formula:C11H12N2O2S
InChI:InChI=1S/C11H12N2O2S/c16-11(12-7-9-3-1-5-14-9)13-8-10-4-2-6-15-10/h1-6H,7-8H2,(H2,12,13,16)
InChI key:InChIKey=UPLWHRBYCKGWOL-UHFFFAOYSA-N
SMILES:C(NC(NCC1=CC=CO1)=S)C2=CC=CO2
Synonyms:- 1,3-Bis(Furan-2-Ylmethyl)Thiourea
- Accelerator DFTU
- N,N′-Bis(2-furanylmethyl)thiourea
- N,N′-Difurfurylthiourea
- NSC 45028
- Thiourea, N,N′-bis(2-furanylmethyl)-
- Urea, 1,3-difurfuryl-2-thio-
- 1,3-(Difurfuryl)thiourea
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.