CAS 102489-48-5

2-{2-[(2-chloro-6-methylphenyl)amino]-2-oxoethoxy}-N,N-diethylethanaminium chloride

Description:

2-{2-[(2-chloro-6-methylphenyl)amino]-2-oxoethoxy}-N,N-diethylethanaminium chloride, with the CAS number 102489-48-5, is a quaternary ammonium compound characterized by its complex structure that includes a diethylamino group and a chloro-substituted aromatic moiety. This compound typically exhibits properties associated with quaternary ammonium salts, such as solubility in water and organic solvents, and it may possess antimicrobial or surfactant properties due to its cationic nature. The presence of the chloro and methyl groups on the aromatic ring can influence its reactivity and biological activity. Additionally, the ethoxy and oxo groups contribute to its overall polarity and potential interactions with biological systems. As with many quaternary ammonium compounds, it may be used in various applications, including pharmaceuticals, disinfectants, or as a surfactant in formulations. Safety and handling precautions are essential, as such compounds can exhibit toxicity or irritant properties depending on concentration and exposure routes.

Formula: C₁₅H₂₄Cl₂N₂O₂

InChI: InChI=1/C15H23ClN2O2.ClH/c1-4-18(5-2)9-10-20-11-14(19)17-15-12(3)7-6-8-13(15)16;/h6-8H,4-5,9-11H2,1-3H3,(H,17,19);1H

SMILES: CCN(CC)CCOCC(=Nc1c(C)cccc1Cl)O.Cl