
CAS 1025-89-4
:5-Methyl-1,3-diphenyl-1H-1,2,4-triazole
Description:
5-Methyl-1,3-diphenyl-1H-1,2,4-triazole is an organic compound characterized by its triazole ring, which is a five-membered heterocyclic structure containing three nitrogen atoms. This compound features two phenyl groups and a methyl group attached to the triazole, contributing to its unique chemical properties. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. The presence of the triazole moiety often imparts biological activity, making such compounds of interest in pharmaceuticals and agrochemicals. Additionally, the substitution pattern on the triazole ring can influence its reactivity and interaction with other molecules, potentially affecting its applications in various fields, including medicinal chemistry and material science. The compound's stability, melting point, and reactivity can vary based on environmental conditions and the presence of other functional groups. Overall, 5-Methyl-1,3-diphenyl-1H-1,2,4-triazole represents a versatile structure with significant implications in chemical research and application.
Formula:C15H13N3
InChI:InChI=1S/C15H13N3/c1-12-16-15(13-8-4-2-5-9-13)17-18(12)14-10-6-3-7-11-14/h2-11H,1H3
InChI key:InChIKey=GDYDLKDQIOOXJY-UHFFFAOYSA-N
SMILES:CC=1N(N=C(N1)C2=CC=CC=C2)C3=CC=CC=C3
Synonyms:- 5-Methyl-1,3-diphenyl-1H-1,2,4-triazole
- 1H-1,2,4-Triazole, 5-methyl-1,3-diphenyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
