CAS 10250-60-9

1,5-Dimethyl-3-phenyl-1H-pyrazole

Description:

1,5-Dimethyl-3-phenyl-1H-pyrazole is an organic compound characterized by its pyrazole ring structure, which consists of a five-membered ring containing two nitrogen atoms at the 1 and 2 positions. This compound features two methyl groups attached to the 1 and 5 positions of the pyrazole ring, contributing to its hydrophobic characteristics, while a phenyl group is substituted at the 3 position, enhancing its aromatic properties. The presence of these substituents influences its reactivity and solubility, making it more soluble in organic solvents than in water. 1,5-Dimethyl-3-phenyl-1H-pyrazole is often studied for its potential applications in pharmaceuticals and agrochemicals, as compounds with pyrazole moieties have been associated with various biological activities. Its molecular structure allows for potential interactions with biological targets, making it a subject of interest in medicinal chemistry. Additionally, the compound's stability and reactivity can be influenced by the electronic effects of the substituents, which may affect its synthesis and application in various chemical reactions.

Formula: C₁₁H₁₂N₂

InChI: InChI=1S/C11H12N2/c1-9-8-11(12-13(9)2)10-6-4-3-5-7-10/h3-8H,1-2H3

InChI key: InChIKey=AVZWCCJQQCROGD-UHFFFAOYSA-N

SMILES: CC1=CC(=NN1C)C2=CC=CC=C2

Synonyms:

• 1H-Pyrazole, 1,5-dimethyl-3-phenyl-
• 1,5-Dimethyl-3-phenylpyrazole
• 1,5-Dimethyl-3-phenyl-1H-pyrazole
• Pyrazole, 1,5-dimethyl-3-phenyl-

1H-Pyrazole, 1,5-dimethyl-3-phenyl-

CAS: 10250-60-9

Formula: C₁₁H₁₂N₂

Molecular weight: 172.2264

Ref: IN-DA0007LF